![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| MQ393_High Resolutio..> | 2016-10-09 14:19 | 753K | |
| MQ401_Terahertz Spec..> | 2016-10-09 14:19 | 1.7M | |
| MQ409 High Resolutio..> | 2018-03-13 17:20 | 1.9M | |
| Abstract_ACS2018 The..> | 2018-03-15 11:24 | 104K | |
| MQ389_Proof of Princ..> | 2018-03-15 15:08 | 1.0M | |
| MQ408 High resoluti..> | 2019-04-30 18:20 | 6.1M | |
| MQ386 TunnelingandPa..> | 2019-05-02 09:25 | 2.1M | |
| MQ387 Wavepacket Dyn..> | 2019-05-02 09:30 | 4.5M | |
| MQ281 Steps Towards ..> | 2019-05-02 09:43 | 427K | |
| MQ70 On the measurem..> | 2019-05-02 09:46 | 612K | |
| MQ373 ON BIOMOLECULA..> | 2019-05-02 10:22 | 393K | |
| MQ335 Fundamental Sy..> | 2019-05-02 10:27 | 674K | |
| MQ 424 The Gigahertz..> | 2019-05-04 17:44 | 1.9M | |
| MQ380 Computation of..> | 2019-05-04 17:47 | 1.6M | |
| MQ100 Structure and ..> | 2019-05-05 18:48 | 1.6M | |
| MQ100D Struktur und ..> | 2019-05-06 08:49 | 1.8M | |
| MQ 432 opt compresse..> | 2021-06-25 11:30 | 2.5M | |
| MQ 438 Mol Phys 2020..> | 2021-06-25 11:30 | 1.3M | |
| AQC published 2020 1..> | 2021-06-25 11:30 | 2.3M | |
| MQ428_Precision expe..> | 2021-06-25 19:45 | 420K | |